- Chemical Name: 2-ethyl-5(or6)-methoxypyrazine
- CAS No.: 68739-00-4
Factory Sells Best Quality 2-ethyl-5(or6)-methoxypyrazine 68739-00-4 with ISO standards
- Molecular Formula: C7H10N2O
- Molecular Weight: 138.1671
- Vapor Pressure: 0.854mmHg at 25°C
- Boiling Point: 187.8°Cat760mmHg
- Flash Point: 67.4°C
- PSA: 35.01000
- Density: 1.041g/cm3
- LogP: 1.04760
2-ethyl-5(or6)-methoxypyrazine(Cas 68739-00-4) Usage
|
General Description |
2-Ethyl-5(or6)-methoxypyrazine is a chemical compound commonly found in natural products such as coffee, cocoa, and bell peppers. It is known for its strong and distinct aroma, often described as earthy, green, and vegetal. 2-ethyl-5(or6)-methoxypyrazine is commonly used in the food and beverage industry as a flavoring agent due to its potent odor, which is often associated with the green and earthy notes present in various fruits and vegetables. Additionally, 2-Ethyl-5(or6)-methoxypyrazine is also utilized in the production of perfumes and other fragrances, where its characteristic scent adds depth and complexity to various aromatic compositions. Its presence can also be detected in some wines, contributing to their unique flavor profiles. |
InChI:InChI=1/C7H10N2O/c1-3-6-4-9-7(10-2)5-8-6/h4-5H,3H2,1-2H3